C20H24N2O3S — CID 23452155
2-[4-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]butyl]isoindole-1,3-dione (PubChem CID 23452155) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-[4-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23452155 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-[4-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]butyl]isoindole-1,3-dione |
| SMILES | CN(C)Cc1ccc(CSCCCCN2C(=O)c3ccccc3C2=O)o1 |
| InChI | InChI=1S/C20H24N2O3S/c1-21(2)13-15-9-10-16(25-15)14-26-12-6-5-11-22-19(23)17-7-3-4-8-18(17)20(22)24/h3-4,7-10H,5-6,11-14H2,1-2H3 |
| InChIKey | CZUBZZAWYBHEOZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|