C13H15NO3S — CID 66115003
2-[2-(3-hydroxypropylsulfanyl)ethyl]isoindole-1,3-dione (PubChem CID 66115003) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropylsulfanyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-hydroxypropylsulfanyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 66115003 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-[2-(3-hydroxypropylsulfanyl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCSCCCO |
| InChI | InChI=1S/C13H15NO3S/c15-7-3-8-18-9-6-14-12(16)10-4-1-2-5-11(10)13(14)17/h1-2,4-5,15H,3,6-9H2 |
| InChIKey | VOWXWMDMAQBFKQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|