C14H17NO4S — CID 174150019
2-[2-(2,2-dimethoxyethylsulfanyl)ethyl]isoindole-1,3-dione (PubChem CID 174150019) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[2-(2,2-dimethoxyethylsulfanyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2,2-dimethoxyethylsulfanyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 174150019 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[2-(2,2-dimethoxyethylsulfanyl)ethyl]isoindole-1,3-dione |
| SMILES | COC(CSCCN1C(=O)c2ccccc2C1=O)OC |
| InChI | InChI=1S/C14H17NO4S/c1-18-12(19-2)9-20-8-7-15-13(16)10-5-3-4-6-11(10)14(15)17/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | OEURKKLJKCFIGY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|