C11H12N2O2S — CID 146639828
2-[2-(methylaminosulfanyl)ethyl]isoindole-1,3-dione (PubChem CID 146639828) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-[2-(methylaminosulfanyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(methylaminosulfanyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 146639828 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-[2-(methylaminosulfanyl)ethyl]isoindole-1,3-dione |
| SMILES | CNSCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H12N2O2S/c1-12-16-7-6-13-10(14)8-4-2-3-5-9(8)11(13)15/h2-5,12H,6-7H2,1H3 |
| InChIKey | TVJHHVKOWGBPCX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|