C18H15N3O3S2 — CID 8853396
2-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 8853396) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8853396 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1sc2nc(SCCN3C(=O)c4ccccc4C3=O)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C18H15N3O3S2/c1-9-10(2)26-15-13(9)14(22)19-18(20-15)25-8-7-21-16(23)11-5-3-4-6-12(11)17(21)24/h3-6H,7-8H2,1-2H3,(H,19,20,22) |
| InChIKey | GICNRXLEMTZMLO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|