C17H18N2OS2 — CID 7309628
2-butylsulfanyl-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 7309628) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2-butylsulfanyl-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-butylsulfanyl-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7309628 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-butylsulfanyl-6-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCCSc1nc2sc(C)c(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N2OS2/c1-3-4-10-21-17-18-15(20)14-13(11(2)22-16(14)19-17)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3,(H,18,19,20) |
| InChIKey | IKVPVZJWIMWCJD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|