C16H14N2OS2 — CID 7575451
6-methyl-5-phenyl-2-prop-2-enylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 7575451) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 6-methyl-5-phenyl-2-prop-2-enylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-5-phenyl-2-prop-2-enylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7575451 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 6-methyl-5-phenyl-2-prop-2-enylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCSc1nc2sc(C)c(-c3ccccc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H14N2OS2/c1-3-9-20-16-17-14(19)13-12(10(2)21-15(13)18-16)11-7-5-4-6-8-11/h3-8H,1,9H2,2H3,(H,17,18,19) |
| InChIKey | BVLIYVLEPKSUQZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|