C14H17NO4S — CID 115677521
2-[3-(2,3-dihydroxypropylsulfanyl)propyl]isoindole-1,3-dione (PubChem CID 115677521) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[3-(2,3-dihydroxypropylsulfanyl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2,3-dihydroxypropylsulfanyl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 115677521 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[3-(2,3-dihydroxypropylsulfanyl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCSCC(O)CO |
| InChI | InChI=1S/C14H17NO4S/c16-8-10(17)9-20-7-3-6-15-13(18)11-4-1-2-5-12(11)14(15)19/h1-2,4-5,10,16-17H,3,6-9H2 |
| InChIKey | RQXSYUQKRCRDKI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|