C10H17NO3S — CID 106305045
1-[2-(3-hydroxypropylsulfanyl)ethyl]piperidine-2,6-dione (PubChem CID 106305045) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-[2-(3-hydroxypropylsulfanyl)ethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-(3-hydroxypropylsulfanyl)ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 106305045 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-[2-(3-hydroxypropylsulfanyl)ethyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1CCSCCCO |
| InChI | InChI=1S/C10H17NO3S/c12-6-2-7-15-8-5-11-9(13)3-1-4-10(11)14/h12H,1-8H2 |
| InChIKey | SJYDVVHDUSJJDE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|