C10H18N2O2S — CID 66230891
1-[2-(2-amino-2-methylpropyl)sulfanylethyl]pyrrolidine-2,5-dione (PubChem CID 66230891) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 1-[2-(2-amino-2-methylpropyl)sulfanylethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(2-amino-2-methylpropyl)sulfanylethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 66230891 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-[2-(2-amino-2-methylpropyl)sulfanylethyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(N)CSCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C10H18N2O2S/c1-10(2,11)7-15-6-5-12-8(13)3-4-9(12)14/h3-7,11H2,1-2H3 |
| InChIKey | FJCCGCDYCWHARZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|