C13H23NO2 — CID 139478689
1-(2,2,4,4-tetramethylpentyl)pyrrolidine-2,5-dione (PubChem CID 139478689) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(2,2,4,4-tetramethylpentyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2,2,4,4-tetramethylpentyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139478689 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-(2,2,4,4-tetramethylpentyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)CC(C)(C)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C13H23NO2/c1-12(2,3)8-13(4,5)9-14-10(15)6-7-11(14)16/h6-9H2,1-5H3 |
| InChIKey | RLISHCSEQCVICE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|