C22H34N6O3S2 — CID 14434275
3-N,4-N-bis[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-oxadiazole-3,4-diamine (PubChem CID 14434275) has the molecular formula C22H34N6O3S2 and a molecular weight of 494.69 g/mol. Its IUPAC name is 3-N,4-N-bis[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-oxadiazole-3,4-diamine.
| Compound Name | 3-N,4-N-bis[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-oxadiazole-3,4-diamine |
|---|---|
| PubChem CID | 14434275 |
| Molecular Formula | C22H34N6O3S2 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 3-N,4-N-bis[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,2,5-oxadiazole-3,4-diamine |
| SMILES | CN(C)Cc1ccc(CSCCNc2nonc2NCCSCc2ccc(CN(C)C)o2)o1 |
| InChI | InChI=1S/C22H34N6O3S2/c1-27(2)13-17-5-7-19(29-17)15-32-11-9-23-21-22(26-31-25-21)24-10-12-33-16-20-8-6-18(30-20)14-28(3)4/h5-8H,9-16H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | WLLURFMXORMKBC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|