C17H20FN3OS — CID 15005007
2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-6-fluorobenzonitrile (PubChem CID 15005007) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-6-fluorobenzonitrile.
| Compound Name | 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 15005007 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-6-fluorobenzonitrile |
| SMILES | CN(C)Cc1ccc(CSCCNc2cccc(F)c2C#N)o1 |
| InChI | InChI=1S/C17H20FN3OS/c1-21(2)11-13-6-7-14(22-13)12-23-9-8-20-17-5-3-4-16(18)15(17)10-19/h3-7,20H,8-9,11-12H2,1-2H3 |
| InChIKey | ADLLVJJAMGWNEL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|