C25H29N3O8S2 — CID 70507423
2-(benzenesulfonamido)-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]benzamide;oxalic acid (PubChem CID 70507423) has the molecular formula C25H29N3O8S2 and a molecular weight of 563.65 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]benzamide;oxalic acid.
| Compound Name | 2-(benzenesulfonamido)-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]benzamide;oxalic acid |
|---|---|
| PubChem CID | 70507423 |
| Molecular Formula | C25H29N3O8S2 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]benzamide;oxalic acid |
| SMILES | CN(C)Cc1ccc(CSCCNC(=O)c2ccccc2NS(=O)(=O)c2ccccc2)o1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H27N3O4S2.C2H2O4/c1-26(2)16-18-12-13-19(30-18)17-31-15-14-24-23(27)21-10-6-7-11-22(21)25-32(28,29)20-8-4-3-5-9-20;3-1(4)2(5)6/h3-13,25H,14-17H2,1-2H3,(H,24,27);(H,3,4)(H,5,6) |
| InChIKey | SCGHVPKQOBTASA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 166.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|