C16H21N3O2S — CID 12831860
N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]pyridine-3-carboxamide (PubChem CID 12831860) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 12831860 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]pyridine-3-carboxamide |
| SMILES | CN(C)Cc1ccc(CSCCNC(=O)c2cccnc2)o1 |
| InChI | InChI=1S/C16H21N3O2S/c1-19(2)11-14-5-6-15(21-14)12-22-9-8-18-16(20)13-4-3-7-17-10-13/h3-7,10H,8-9,11-12H2,1-2H3,(H,18,20) |
| InChIKey | FKIQKJLDQAGEJE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|