C19H27N5O4S — CID 70357029
2-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-1-pyridin-3-ylethanol (PubChem CID 70357029) has the molecular formula C19H27N5O4S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-1-pyridin-3-ylethanol.
| Compound Name | 2-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 70357029 |
| Molecular Formula | C19H27N5O4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-1-pyridin-3-ylethanol |
| SMILES | CN(C)Cc1ccc(CSCCNC(=C[N+](=O)[O-])NCC(O)c2cccnc2)o1 |
| InChI | InChI=1S/C19H27N5O4S/c1-23(2)12-16-5-6-17(28-16)14-29-9-8-21-19(13-24(26)27)22-11-18(25)15-4-3-7-20-10-15/h3-7,10,13,18,21-22,25H,8-9,11-12,14H2,1-2H3 |
| InChIKey | YDJVFWWALYMAFU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 116.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|