C25H36N4O5S — CID 70430264
1-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-3-(1-methoxy-2,3-dihydroinden-1-yl)propan-2-ol (PubChem CID 70430264) has the molecular formula C25H36N4O5S and a molecular weight of 504.65 g/mol. Its IUPAC name is 1-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-3-(1-methoxy-2,3-dihydroinden-1-yl)propan-2-ol.
| Compound Name | 1-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-3-(1-methoxy-2,3-dihydroinden-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 70430264 |
| Molecular Formula | C25H36N4O5S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[[1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenyl]amino]-3-(1-methoxy-2,3-dihydroinden-1-yl)propan-2-ol |
| SMILES | COC1(CC(O)CNC(=C[N+](=O)[O-])NCCSCc2ccc(CN(C)C)o2)CCc2ccccc21 |
| InChI | InChI=1S/C25H36N4O5S/c1-28(2)16-21-8-9-22(34-21)18-35-13-12-26-24(17-29(31)32)27-15-20(30)14-25(33-3)11-10-19-6-4-5-7-23(19)25/h4-9,17,20,26-27,30H,10-16,18H2,1-3H3 |
| InChIKey | DAKFQHZDAXGXIK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|