C19H31N5OS2 — CID 13210772
1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethylimidazol-1-yl)propyl]thiourea (PubChem CID 13210772) has the molecular formula C19H31N5OS2 and a molecular weight of 409.63 g/mol. Its IUPAC name is 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethylimidazol-1-yl)propyl]thiourea.
| Compound Name | 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethylimidazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 13210772 |
| Molecular Formula | C19H31N5OS2 |
| Molecular Weight | 409.63 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethylimidazol-1-yl)propyl]thiourea |
| SMILES | CCc1nccn1CCCNC(=S)NCCSCc1ccc(CN(C)C)o1 |
| InChI | InChI=1S/C19H31N5OS2/c1-4-18-20-9-12-24(18)11-5-8-21-19(26)22-10-13-27-15-17-7-6-16(25-17)14-23(2)3/h6-7,9,12H,4-5,8,10-11,13-15H2,1-3H3,(H2,21,22,26) |
| InChIKey | LJDLWAMQEPPYFC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|