C18H29N5OS2 — CID 13210774
1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(4-methylimidazol-1-yl)propyl]thiourea (PubChem CID 13210774) has the molecular formula C18H29N5OS2 and a molecular weight of 395.60 g/mol. Its IUPAC name is 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(4-methylimidazol-1-yl)propyl]thiourea.
| Compound Name | 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(4-methylimidazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 13210774 |
| Molecular Formula | C18H29N5OS2 |
| Molecular Weight | 395.60 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(4-methylimidazol-1-yl)propyl]thiourea |
| SMILES | Cc1cn(CCCNC(=S)NCCSCc2ccc(CN(C)C)o2)cn1 |
| InChI | InChI=1S/C18H29N5OS2/c1-15-11-23(14-21-15)9-4-7-19-18(25)20-8-10-26-13-17-6-5-16(24-17)12-22(2)3/h5-6,11,14H,4,7-10,12-13H2,1-3H3,(H2,19,20,25) |
| InChIKey | GCWDZMJINKYYSA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|