C20H33N5OS2 — CID 54300435
1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethyl-4-methylimidazol-1-yl)propyl]thiourea (PubChem CID 54300435) has the molecular formula C20H33N5OS2 and a molecular weight of 423.65 g/mol. Its IUPAC name is 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethyl-4-methylimidazol-1-yl)propyl]thiourea.
| Compound Name | 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethyl-4-methylimidazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 54300435 |
| Molecular Formula | C20H33N5OS2 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-3-[3-(2-ethyl-4-methylimidazol-1-yl)propyl]thiourea |
| SMILES | CCc1nc(C)cn1CCCNC(=S)NCCSCc1ccc(CN(C)C)o1 |
| InChI | InChI=1S/C20H33N5OS2/c1-5-19-23-16(2)13-25(19)11-6-9-21-20(27)22-10-12-28-15-18-8-7-17(26-18)14-24(3)4/h7-8,13H,5-6,9-12,14-15H2,1-4H3,(H2,21,22,27) |
| InChIKey | SDULMJNTZQQZNB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|