C18H21ClF3N3OS2 — CID 5159621
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]thiourea (PubChem CID 5159621) has the molecular formula C18H21ClF3N3OS2 and a molecular weight of 451.97 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]thiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]thiourea |
|---|---|
| PubChem CID | 5159621 |
| Molecular Formula | C18H21ClF3N3OS2 |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]thiourea |
| SMILES | CN(C)Cc1ccc(CSCCNC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C18H21ClF3N3OS2/c1-25(2)10-13-4-5-14(26-13)11-28-8-7-23-17(27)24-12-3-6-16(19)15(9-12)18(20,21)22/h3-6,9H,7-8,10-11H2,1-2H3,(H2,23,24,27) |
| InChIKey | XMPVZGVIDSUWEV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|