C12H18N4OS — CID 10801728
N-cyano-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]methanimidamide (PubChem CID 10801728) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is N-cyano-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]methanimidamide.
| Compound Name | N-cyano-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]methanimidamide |
|---|---|
| PubChem CID | 10801728 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-cyano-N'-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]methanimidamide |
| SMILES | CN(C)Cc1ccc(CSCC/N=C/NC#N)o1 |
| InChI | InChI=1S/C12H18N4OS/c1-16(2)7-11-3-4-12(17-11)8-18-6-5-14-10-15-9-13/h3-4,10H,5-8H2,1-2H3,(H,14,15) |
| InChIKey | KUOBEYNMHGZBEB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|