C14H20F3N5O3S2 — CID 135849594
1-[5-[2-[[1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazolidin-3-ylidene]amino]ethylsulfanylmethyl]furan-2-yl]-N,N-dimethylmethanamine (PubChem CID 135849594) has the molecular formula C14H20F3N5O3S2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 1-[5-[2-[[1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazolidin-3-ylidene]amino]ethylsulfanylmethyl]furan-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[5-[2-[[1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazolidin-3-ylidene]amino]ethylsulfanylmethyl]furan-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 135849594 |
| Molecular Formula | C14H20F3N5O3S2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 1-[5-[2-[[1,1-dioxo-4-(2,2,2-trifluoroethylimino)-1,2,5-thiadiazolidin-3-ylidene]amino]ethylsulfanylmethyl]furan-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccc(CSCC/N=C2\NS(=O)(=O)N\C2=N\CC(F)(F)F)o1 |
| InChI | InChI=1S/C14H20F3N5O3S2/c1-22(2)7-10-3-4-11(25-10)8-26-6-5-18-12-13(19-9-14(15,16)17)21-27(23,24)20-12/h3-4H,5-9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | MAXBUJWKXKPLLS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|