C17H22N4O5S4 — CID 136821701
3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-1,1-dioxo-1λ6,4,2-benzodithiazine-7-sulfonamide (PubChem CID 136821701) has the molecular formula C17H22N4O5S4 and a molecular weight of 490.65 g/mol. Its IUPAC name is 3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-1,1-dioxo-1λ6,4,2-benzodithiazine-7-sulfonamide.
| Compound Name | 3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-1,1-dioxo-1λ6,4,2-benzodithiazine-7-sulfonamide |
|---|---|
| PubChem CID | 136821701 |
| Molecular Formula | C17H22N4O5S4 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-1,1-dioxo-1λ6,4,2-benzodithiazine-7-sulfonamide |
| SMILES | CN(C)Cc1ccc(CSCC/N=C2/NS(=O)(=O)c3cc(S(N)(=O)=O)ccc3S2)o1 |
| InChI | InChI=1S/C17H22N4O5S4/c1-21(2)10-12-3-4-13(26-12)11-27-8-7-19-17-20-30(24,25)16-9-14(29(18,22)23)5-6-15(16)28-17/h3-6,9H,7-8,10-11H2,1-2H3,(H,19,20)(H2,18,22,23) |
| InChIKey | HPUQCHLARFQIIR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|