C13H21N5O2S2 — CID 173416095
4-[2-[[5-[2-(dimethylamino)ethyl]furan-2-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine (PubChem CID 173416095) has the molecular formula C13H21N5O2S2 and a molecular weight of 343.48 g/mol. Its IUPAC name is 4-[2-[[5-[2-(dimethylamino)ethyl]furan-2-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine.
| Compound Name | 4-[2-[[5-[2-(dimethylamino)ethyl]furan-2-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine |
|---|---|
| PubChem CID | 173416095 |
| Molecular Formula | C13H21N5O2S2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-[2-[[5-[2-(dimethylamino)ethyl]furan-2-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine |
| SMILES | CN(C)CCc1ccc(CSCC/N=c2\[nH][s+]([O-])nc2N)o1 |
| InChI | InChI=1S/C13H21N5O2S2/c1-18(2)7-5-10-3-4-11(20-10)9-21-8-6-15-13-12(14)16-22(19)17-13/h3-4H,5-9H2,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | FEYGYHQAYQRKEE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|