C14H20N6O2S — CID 173361549
(Z)-1-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]-4-[4-[(dimethylamino)methyl]-2-pyridinyl]but-2-en-2-ol (PubChem CID 173361549) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is (Z)-1-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]-4-[4-[(dimethylamino)methyl]-2-pyridinyl]but-2-en-2-ol.
| Compound Name | (Z)-1-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]-4-[4-[(dimethylamino)methyl]-2-pyridinyl]but-2-en-2-ol |
|---|---|
| PubChem CID | 173361549 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (Z)-1-[(4-amino-1-oxido-1,2,5-thiadiazol-1-ium-3-ylidene)amino]-4-[4-[(dimethylamino)methyl]-2-pyridinyl]but-2-en-2-ol |
| SMILES | CN(C)Cc1ccnc(C/C=C(\O)C/N=c2\[nH][s+]([O-])nc2N)c1 |
| InChI | InChI=1S/C14H20N6O2S/c1-20(2)9-10-5-6-16-11(7-10)3-4-12(21)8-17-14-13(15)18-23(22)19-14/h4-7,21H,3,8-9H2,1-2H3,(H2,15,18)(H,17,19)/b12-4- |
| InChIKey | CQQIJDZPZXDVSC-QCDXTXTGSA-N |
| XLogP | 0.76 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|