C10H16N6OS3 — CID 173393918
4-[2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine (PubChem CID 173393918) has the molecular formula C10H16N6OS3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 4-[2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine.
| Compound Name | 4-[2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine |
|---|---|
| PubChem CID | 173393918 |
| Molecular Formula | C10H16N6OS3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 4-[2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine |
| SMILES | CN(C)c1nc(CSCC/N=c2\[nH][s+]([O-])nc2N)cs1 |
| InChI | InChI=1S/C10H16N6OS3/c1-16(2)10-13-7(6-19-10)5-18-4-3-12-9-8(11)14-20(17)15-9/h6H,3-5H2,1-2H3,(H2,11,14)(H,12,15) |
| InChIKey | LMOKQOXCMBLFLR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|