C9H12ClN5O2S3 — CID 135849574
3-N-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine (PubChem CID 135849574) has the molecular formula C9H12ClN5O2S3 and a molecular weight of 353.88 g/mol. Its IUPAC name is 3-N-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine.
| Compound Name | 3-N-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
|---|---|
| PubChem CID | 135849574 |
| Molecular Formula | C9H12ClN5O2S3 |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 3-N-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N\CCSCc1csc(Cl)n1 |
| InChI | InChI=1S/C9H12ClN5O2S3/c1-11-7-8(15-20(16,17)14-7)12-2-3-18-4-6-5-19-9(10)13-6/h5H,2-4H2,1H3,(H,11,14)(H,12,15) |
| InChIKey | VUXHIHAGHXQROR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|