C8H12ClN3OS3 — CID 57087631
3-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea (PubChem CID 57087631) has the molecular formula C8H12ClN3OS3 and a molecular weight of 297.86 g/mol. Its IUPAC name is 3-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea.
| Compound Name | 3-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea |
|---|---|
| PubChem CID | 57087631 |
| Molecular Formula | C8H12ClN3OS3 |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 3-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea |
| SMILES | CN(S)C(=O)NCCSCc1csc(Cl)n1 |
| InChI | InChI=1S/C8H12ClN3OS3/c1-12(14)8(13)10-2-3-15-4-6-5-16-7(9)11-6/h5,14H,2-4H2,1H3,(H,10,13) |
| InChIKey | LIHUVUSUEWKUMQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|