C9H13ClN4OS2 — CID 88795306
3-[2-[(2-chloropyrimidin-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea (PubChem CID 88795306) has the molecular formula C9H13ClN4OS2 and a molecular weight of 292.82 g/mol. Its IUPAC name is 3-[2-[(2-chloropyrimidin-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea.
| Compound Name | 3-[2-[(2-chloropyrimidin-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea |
|---|---|
| PubChem CID | 88795306 |
| Molecular Formula | C9H13ClN4OS2 |
| Molecular Weight | 292.82 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 3-[2-[(2-chloropyrimidin-4-yl)methylsulfanyl]ethyl]-1-methyl-1-sulfanylurea |
| SMILES | CN(S)C(=O)NCCSCc1ccnc(Cl)n1 |
| InChI | InChI=1S/C9H13ClN4OS2/c1-14(16)9(15)12-4-5-17-6-7-2-3-11-8(10)13-7/h2-3,16H,4-6H2,1H3,(H,12,15) |
| InChIKey | GUHAMIFXPSHKHA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.82 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|