C8H12ClN3OS3 — CID 88760654
1-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethylsulfanyl]-3-methylurea (PubChem CID 88760654) has the molecular formula C8H12ClN3OS3 and a molecular weight of 297.86 g/mol. Its IUPAC name is 1-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethylsulfanyl]-3-methylurea.
| Compound Name | 1-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethylsulfanyl]-3-methylurea |
|---|---|
| PubChem CID | 88760654 |
| Molecular Formula | C8H12ClN3OS3 |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 1-[2-[(2-chloro-1,3-thiazol-4-yl)methylsulfanyl]ethylsulfanyl]-3-methylurea |
| SMILES | CNC(=O)NSCCSCc1csc(Cl)n1 |
| InChI | InChI=1S/C8H12ClN3OS3/c1-10-8(13)12-16-3-2-14-4-6-5-15-7(9)11-6/h5H,2-4H2,1H3,(H2,10,12,13) |
| InChIKey | UTPRKPZHGRQAIO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|