C16H20N2OS2 — CID 56789231
N-(2-benzylsulfanylethyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide (PubChem CID 56789231) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide.
| Compound Name | N-(2-benzylsulfanylethyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 56789231 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-3-(2-methyl-1,3-thiazol-4-yl)propanamide |
| SMILES | Cc1nc(CCC(=O)NCCSCc2ccccc2)cs1 |
| InChI | InChI=1S/C16H20N2OS2/c1-13-18-15(12-21-13)7-8-16(19)17-9-10-20-11-14-5-3-2-4-6-14/h2-6,12H,7-11H2,1H3,(H,17,19) |
| InChIKey | NMLAXVTXWDBDOP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|