C10H16N8O2S3 — CID 135849588
2-[4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 135849588) has the molecular formula C10H16N8O2S3 and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-[4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 135849588 |
| Molecular Formula | C10H16N8O2S3 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-[4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N\CCSCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C10H16N8O2S3/c1-13-7-8(18-23(19,20)17-7)14-2-3-21-4-6-5-22-10(15-6)16-9(11)12/h5H,2-4H2,1H3,(H,13,17)(H,14,18)(H4,11,12,15,16) |
| InChIKey | VQEPPUBBBNTOTB-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|