C8H13N6O3S3- — CID 175114181
2-(diaminomethylideneamino)-4-[[3-oxo-3-(2-sulfinatohydrazinyl)propyl]sulfanylmethyl]-1,3-thiazole (PubChem CID 175114181) has the molecular formula C8H13N6O3S3- and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-4-[[3-oxo-3-(2-sulfinatohydrazinyl)propyl]sulfanylmethyl]-1,3-thiazole.
| Compound Name | 2-(diaminomethylideneamino)-4-[[3-oxo-3-(2-sulfinatohydrazinyl)propyl]sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 175114181 |
| Molecular Formula | C8H13N6O3S3- |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-(diaminomethylideneamino)-4-[[3-oxo-3-(2-sulfinatohydrazinyl)propyl]sulfanylmethyl]-1,3-thiazole |
| SMILES | NC(N)=Nc1nc(CSCCC(=O)NNS(=O)[O-])cs1 |
| InChI | InChI=1S/C8H14N6O3S3/c9-7(10)12-8-11-5(4-19-8)3-18-2-1-6(15)13-14-20(16)17/h4,14H,1-3H2,(H,13,15)(H,16,17)(H4,9,10,11,12)/p-1 |
| InChIKey | PKLMIHYJNDCBIK-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 158.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|