C9H15N6O2S3- — CID 172938834
2-(diaminomethylideneamino)-4-[[(3Z)-3-(sulfinatohydrazinylidene)butyl]sulfanylmethyl]-1,3-thiazole (PubChem CID 172938834) has the molecular formula C9H15N6O2S3- and a molecular weight of 335.46 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-4-[[(3Z)-3-(sulfinatohydrazinylidene)butyl]sulfanylmethyl]-1,3-thiazole.
| Compound Name | 2-(diaminomethylideneamino)-4-[[(3Z)-3-(sulfinatohydrazinylidene)butyl]sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 172938834 |
| Molecular Formula | C9H15N6O2S3- |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-(diaminomethylideneamino)-4-[[(3Z)-3-(sulfinatohydrazinylidene)butyl]sulfanylmethyl]-1,3-thiazole |
| SMILES | C/C(CCSCc1csc(N=C(N)N)n1)=N/NS(=O)[O-] |
| InChI | InChI=1S/C9H16N6O2S3/c1-6(14-15-20(16)17)2-3-18-4-7-5-19-9(12-7)13-8(10)11/h5,15H,2-4H2,1H3,(H,16,17)(H4,10,11,12,13)/p-1/b14-6- |
| InChIKey | FMYSWDHDHYYTPR-NSIKDUERSA-M |
| XLogP | 0.43 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|