C7H14N5S2+ — CID 4192536
2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylazanium (PubChem CID 4192536) has the molecular formula C7H14N5S2+ and a molecular weight of 232.36 g/mol. Its IUPAC name is 2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylazanium.
| Compound Name | 2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylazanium |
|---|---|
| PubChem CID | 4192536 |
| Molecular Formula | C7H14N5S2+ |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethylazanium |
| SMILES | NC(N)=Nc1nc(CSCC[NH3+])cs1 |
| InChI | InChI=1S/C7H13N5S2/c8-1-2-13-3-5-4-14-7(11-5)12-6(9)10/h4H,1-3,8H2,(H4,9,10,11,12)/p+1 |
| InChIKey | JFINSZHXZPNADJ-UHFFFAOYSA-O |
| XLogP | -0.48 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|