C6H10N4S — CID 15636971
2-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 15636971) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 15636971 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | Cc1csc(CN=C(N)N)n1 |
| InChI | InChI=1S/C6H10N4S/c1-4-3-11-5(10-4)2-9-6(7)8/h3H,2H2,1H3,(H4,7,8,9) |
| InChIKey | MKLKQCNNSKNNOD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|