C5H8N2S — CID 4667189
(4-methyl-1,3-thiazol-2-yl)methanamine (PubChem CID 4667189) has the molecular formula C5H8N2S and a molecular weight of 128.20 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)methanamine.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 4667189 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)methanamine |
| SMILES | Cc1csc(CN)n1 |
| InChI | InChI=1S/C5H8N2S/c1-4-3-8-5(2-6)7-4/h3H,2,6H2,1H3 |
| InChIKey | OJEGLCVIHVSMMR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |