C9H13N7O2S3 — CID 172858602
2-[4-[2-(1,1-dioxo-4H-1,2,4,6-thiatriazin-3-yl)ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 172858602) has the molecular formula C9H13N7O2S3 and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-[4-[2-(1,1-dioxo-4H-1,2,4,6-thiatriazin-3-yl)ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[2-(1,1-dioxo-4H-1,2,4,6-thiatriazin-3-yl)ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 172858602 |
| Molecular Formula | C9H13N7O2S3 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2-[4-[2-(1,1-dioxo-4H-1,2,4,6-thiatriazin-3-yl)ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | NC(N)=Nc1nc(CSCCC2=NS(=O)(=O)N=CN2)cs1 |
| InChI | InChI=1S/C9H13N7O2S3/c10-8(11)15-9-14-6(4-20-9)3-19-2-1-7-12-5-13-21(17,18)16-7/h4-5H,1-3H2,(H,12,13,16)(H4,10,11,14,15) |
| InChIKey | ZAXPSDIZRPMEJW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|