C11H18N8S2 — CID 57203294
2-cyano-1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-ethylguanidine (PubChem CID 57203294) has the molecular formula C11H18N8S2 and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-cyano-1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-ethylguanidine.
| Compound Name | 2-cyano-1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-ethylguanidine |
|---|---|
| PubChem CID | 57203294 |
| Molecular Formula | C11H18N8S2 |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-cyano-1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-1-ethylguanidine |
| SMILES | CCN(CCSCc1csc(N=C(N)N)n1)/C(N)=N/C#N |
| InChI | InChI=1S/C11H18N8S2/c1-2-19(10(15)16-7-12)3-4-20-5-8-6-21-11(17-8)18-9(13)14/h6H,2-5H2,1H3,(H2,15,16)(H4,13,14,17,18) |
| InChIKey | AVXMQFOZCCESJG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|