C12H20N8O2S3 — CID 135849646
N-imidazolidin-2-yl-4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-amine (PubChem CID 135849646) has the molecular formula C12H20N8O2S3 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-imidazolidin-2-yl-4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-amine.
| Compound Name | N-imidazolidin-2-yl-4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135849646 |
| Molecular Formula | C12H20N8O2S3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-imidazolidin-2-yl-4-[2-[(4-methylimino-1,1-dioxo-1,2,5-thiadiazolidin-3-ylidene)amino]ethylsulfanylmethyl]-1,3-thiazol-2-amine |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N\CCSCc1csc(NC2NCCN2)n1 |
| InChI | InChI=1S/C12H20N8O2S3/c1-13-9-10(20-25(21,22)19-9)14-4-5-23-6-8-7-24-12(17-8)18-11-15-2-3-16-11/h7,11,15-16H,2-6H2,1H3,(H,13,19)(H,14,20)(H,17,18) |
| InChIKey | HOFOUXQDMIQLQQ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|