C10H17N3OS2 — CID 66233966
N-[4-(3-aminobutylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 66233966) has the molecular formula C10H17N3OS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-[4-(3-aminobutylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-(3-aminobutylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 66233966 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[4-(3-aminobutylsulfanylmethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CSCCC(C)N)cs1 |
| InChI | InChI=1S/C10H17N3OS2/c1-7(11)3-4-15-5-9-6-16-10(13-9)12-8(2)14/h6-7H,3-5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | XLCMKQRNJRKYET-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|