C9H12ClN3O2S2 — CID 16820645
N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-2-chloropropanamide (PubChem CID 16820645) has the molecular formula C9H12ClN3O2S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-2-chloropropanamide.
| Compound Name | N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-2-chloropropanamide |
|---|---|
| PubChem CID | 16820645 |
| Molecular Formula | C9H12ClN3O2S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-2-chloropropanamide |
| SMILES | CC(Cl)C(=O)Nc1nc(CSCC(N)=O)cs1 |
| InChI | InChI=1S/C9H12ClN3O2S2/c1-5(10)8(15)13-9-12-6(3-17-9)2-16-4-7(11)14/h3,5H,2,4H2,1H3,(H2,11,14)(H,12,13,15) |
| InChIKey | DIJMAHGTGCPBJA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|