C15H15N3O2S2 — CID 16820654
(E)-N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide (PubChem CID 16820654) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (E)-N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16820654 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (E)-N-[4-[(2-amino-2-oxoethyl)sulfanylmethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide |
| SMILES | NC(=O)CSCc1csc(NC(=O)/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C15H15N3O2S2/c16-13(19)10-21-8-12-9-22-15(17-12)18-14(20)7-6-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H2,16,19)(H,17,18,20)/b7-6+ |
| InChIKey | RALZGXHFTWCYEM-VOTSOKGWSA-N |
| XLogP | 2.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|