C19H23N3O2S — CID 51931192
(E)-N-[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide (PubChem CID 51931192) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (E)-N-[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 51931192 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (E)-N-[4-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide |
| SMILES | C[C@@H]1CN(Cc2csc(NC(=O)/C=C/c3ccccc3)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H23N3O2S/c1-14-10-22(11-15(2)24-14)12-17-13-25-19(20-17)21-18(23)9-8-16-6-4-3-5-7-16/h3-9,13-15H,10-12H2,1-2H3,(H,20,21,23)/b9-8+/t14-,15+ |
| InChIKey | CGYHNIXFBCMPPB-WNJITKBNSA-N |
| XLogP | 3.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|