C11H19N3S — CID 62961905
4-ethyl-N-(1-methylpiperidin-4-yl)-1,3-thiazol-2-amine (PubChem CID 62961905) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 4-ethyl-N-(1-methylpiperidin-4-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(1-methylpiperidin-4-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62961905 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 4-ethyl-N-(1-methylpiperidin-4-yl)-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NC2CCN(C)CC2)n1 |
| InChI | InChI=1S/C11H19N3S/c1-3-9-8-15-11(12-9)13-10-4-6-14(2)7-5-10/h8,10H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | SKXLAVUWRVVQKE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |