C10H15FN2S — CID 130607879
4-ethyl-N-(3-fluorocyclopentyl)-1,3-thiazol-2-amine (PubChem CID 130607879) has the molecular formula C10H15FN2S and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-ethyl-N-(3-fluorocyclopentyl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(3-fluorocyclopentyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130607879 |
| Molecular Formula | C10H15FN2S |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-ethyl-N-(3-fluorocyclopentyl)-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NC2CCC(F)C2)n1 |
| InChI | InChI=1S/C10H15FN2S/c1-2-8-6-14-10(12-8)13-9-4-3-7(11)5-9/h6-7,9H,2-5H2,1H3,(H,12,13) |
| InChIKey | QYNNADCZCHNREC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |