C9H17N5S2 — CID 13102900
1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine (PubChem CID 13102900) has the molecular formula C9H17N5S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine.
| Compound Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 13102900 |
| Molecular Formula | C9H17N5S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)Nc1nc(CSCCN)cs1 |
| InChI | InChI=1S/C9H17N5S2/c1-11-8(12-2)14-9-13-7(6-16-9)5-15-4-3-10/h6H,3-5,10H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | VHHYCXRKOXQITH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|