C10H14F5N5S2 — CID 21298717
1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3,3-pentafluoropropyl)guanidine (PubChem CID 21298717) has the molecular formula C10H14F5N5S2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3,3-pentafluoropropyl)guanidine.
| Compound Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3,3-pentafluoropropyl)guanidine |
|---|---|
| PubChem CID | 21298717 |
| Molecular Formula | C10H14F5N5S2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,3,3,3-pentafluoropropyl)guanidine |
| SMILES | NCCSCc1csc(N/C(N)=N/CC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H14F5N5S2/c11-9(12,10(13,14)15)5-18-7(17)20-8-19-6(4-22-8)3-21-2-1-16/h4H,1-3,5,16H2,(H3,17,18,19,20) |
| InChIKey | PSSKAMLFOAWLQX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|