C12H18F3N7O2S2 — CID 154233227
1-[4-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 154233227) has the molecular formula C12H18F3N7O2S2 and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[4-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[4-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 154233227 |
| Molecular Formula | C12H18F3N7O2S2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-[4-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | CNC(=C[N+](=O)[O-])NCCSCc1csc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H18F3N7O2S2/c1-17-9(4-22(23)24)18-2-3-25-5-8-6-26-11(20-8)21-10(16)19-7-12(13,14)15/h4,6,17-18H,2-3,5,7H2,1H3,(H3,16,19,20,21) |
| InChIKey | CPONSZJMPSCWGJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|